C9H16N4O2S2 — CID 60808304
3-amino-N,1-dimethyl-N-(thiolan-3-yl)pyrazole-4-sulfonamide (PubChem CID 60808304) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 3-amino-N,1-dimethyl-N-(thiolan-3-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-N,1-dimethyl-N-(thiolan-3-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808304 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-amino-N,1-dimethyl-N-(thiolan-3-yl)pyrazole-4-sulfonamide |
| SMILES | CN(C1CCSC1)S(=O)(=O)c1cn(C)nc1N |
| InChI | InChI=1S/C9H16N4O2S2/c1-12-5-8(9(10)11-12)17(14,15)13(2)7-3-4-16-6-7/h5,7H,3-4,6H2,1-2H3,(H2,10,11) |
| InChIKey | FECRTRZBZGLQOA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |