C10H14N4O4S2 — CID 80745555
[5-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-3-nitrothiophen-2-yl]hydrazine (PubChem CID 80745555) has the molecular formula C10H14N4O4S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is [5-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-3-nitrothiophen-2-yl]hydrazine.
| Compound Name | [5-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-3-nitrothiophen-2-yl]hydrazine |
|---|---|
| PubChem CID | 80745555 |
| Molecular Formula | C10H14N4O4S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | [5-(2-azabicyclo[2.2.1]heptan-2-ylsulfonyl)-3-nitrothiophen-2-yl]hydrazine |
| SMILES | NNc1sc(S(=O)(=O)N2CC3CCC2C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O4S2/c11-12-10-8(14(15)16)4-9(19-10)20(17,18)13-5-6-1-2-7(13)3-6/h4,6-7,12H,1-3,5,11H2 |
| InChIKey | CKHWPXMOLUITOY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|