C10H15N3O5S2 — CID 80746916
N-methyl-5-(3-methylmorpholin-4-yl)sulfonyl-3-nitrothiophen-2-amine (PubChem CID 80746916) has the molecular formula C10H15N3O5S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-methyl-5-(3-methylmorpholin-4-yl)sulfonyl-3-nitrothiophen-2-amine.
| Compound Name | N-methyl-5-(3-methylmorpholin-4-yl)sulfonyl-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 80746916 |
| Molecular Formula | C10H15N3O5S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N-methyl-5-(3-methylmorpholin-4-yl)sulfonyl-3-nitrothiophen-2-amine |
| SMILES | CNc1sc(S(=O)(=O)N2CCOCC2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O5S2/c1-7-6-18-4-3-12(7)20(16,17)9-5-8(13(14)15)10(11-2)19-9/h5,7,11H,3-4,6H2,1-2H3 |
| InChIKey | GBFQUWMYLUFSGA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|