C9H12N4O5S2 — CID 80747006
4-[5-(methylamino)-4-nitrothiophen-2-yl]sulfonylpiperazin-2-one (PubChem CID 80747006) has the molecular formula C9H12N4O5S2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-[5-(methylamino)-4-nitrothiophen-2-yl]sulfonylpiperazin-2-one.
| Compound Name | 4-[5-(methylamino)-4-nitrothiophen-2-yl]sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 80747006 |
| Molecular Formula | C9H12N4O5S2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-[5-(methylamino)-4-nitrothiophen-2-yl]sulfonylpiperazin-2-one |
| SMILES | CNc1sc(S(=O)(=O)N2CCNC(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O5S2/c1-10-9-6(13(15)16)4-8(19-9)20(17,18)12-3-2-11-7(14)5-12/h4,10H,2-3,5H2,1H3,(H,11,14) |
| InChIKey | OOQITMUBTVDFBF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|