C13H19N3O3S — CID 107328595
4-[2,6-dimethyl-4-(methylamino)phenyl]sulfonylpiperazin-2-one (PubChem CID 107328595) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-(methylamino)phenyl]sulfonylpiperazin-2-one.
| Compound Name | 4-[2,6-dimethyl-4-(methylamino)phenyl]sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 107328595 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[2,6-dimethyl-4-(methylamino)phenyl]sulfonylpiperazin-2-one |
| SMILES | CNc1cc(C)c(S(=O)(=O)N2CCNC(=O)C2)c(C)c1 |
| InChI | InChI=1S/C13H19N3O3S/c1-9-6-11(14-3)7-10(2)13(9)20(18,19)16-5-4-15-12(17)8-16/h6-7,14H,4-5,8H2,1-3H3,(H,15,17) |
| InChIKey | DGKJWGUCZFXRDI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |