C15H25N3O2S — CID 107328424
N,3,5-trimethyl-4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline (PubChem CID 107328424) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is N,3,5-trimethyl-4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline.
| Compound Name | N,3,5-trimethyl-4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 107328424 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N,3,5-trimethyl-4-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
| SMILES | CNc1cc(C)c(S(=O)(=O)N2CCCN(C)CC2)c(C)c1 |
| InChI | InChI=1S/C15H25N3O2S/c1-12-10-14(16-3)11-13(2)15(12)21(19,20)18-7-5-6-17(4)8-9-18/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | CHAVYMDVAJSZER-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |