C12H16Cl3N2O2S- — CID 53350706
1-(3,4-dichlorophenyl)sulfonyl-4-methyl-1,4-diazepane chloride (PubChem CID 53350706) has the molecular formula C12H16Cl3N2O2S- and a molecular weight of 358.70 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonyl-4-methyl-1,4-diazepane chloride.
| Compound Name | 1-(3,4-dichlorophenyl)sulfonyl-4-methyl-1,4-diazepane chloride |
|---|---|
| PubChem CID | 53350706 |
| Molecular Formula | C12H16Cl3N2O2S- |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonyl-4-methyl-1,4-diazepane chloride |
| SMILES | CN1CCCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1.[Cl-] |
| InChI | InChI=1S/C12H16Cl2N2O2S.ClH/c1-15-5-2-6-16(8-7-15)19(17,18)10-3-4-11(13)12(14)9-10;/h3-4,9H,2,5-8H2,1H3;1H/p-1 |
| InChIKey | QEEJWCVZQDMNPO-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |