C12H20ClN5O6S2 — CID 161287993
1-(4-chloro-3-nitrophenyl)sulfonyl-4-methyl-1,4-diazepane;sulfamide (PubChem CID 161287993) has the molecular formula C12H20ClN5O6S2 and a molecular weight of 429.91 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methyl-1,4-diazepane;sulfamide.
| Compound Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methyl-1,4-diazepane;sulfamide |
|---|---|
| PubChem CID | 161287993 |
| Molecular Formula | C12H20ClN5O6S2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)sulfonyl-4-methyl-1,4-diazepane;sulfamide |
| SMILES | CN1CCCN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC1.NS(N)(=O)=O |
| InChI | InChI=1S/C12H16ClN3O4S.H4N2O2S/c1-14-5-2-6-15(8-7-14)21(19,20)10-3-4-11(13)12(9-10)16(17)18;1-5(2,3)4/h3-4,9H,2,5-8H2,1H3;(H4,1,2,3,4) |
| InChIKey | VFYZXDUCFONUMV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 169.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|