C11H14ClN3O4S — CID 62061632
[1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 62061632) has the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. Its IUPAC name is [1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 62061632 |
| Molecular Formula | C11H14ClN3O4S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | [1-(4-chloro-3-nitrophenyl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C11H14ClN3O4S/c12-10-2-1-9(5-11(10)15(16)17)20(18,19)14-4-3-8(6-13)7-14/h1-2,5,8H,3-4,6-7,13H2 |
| InChIKey | ISVIFQZTSZBMAE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|