C9H12ClN3O4S2 — CID 80742140
[1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 80742140) has the molecular formula C9H12ClN3O4S2 and a molecular weight of 325.80 g/mol. Its IUPAC name is [1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 80742140 |
| Molecular Formula | C9H12ClN3O4S2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | [1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)C1 |
| InChI | InChI=1S/C9H12ClN3O4S2/c10-9-7(13(14)15)3-8(18-9)19(16,17)12-2-1-6(4-11)5-12/h3,6H,1-2,4-5,11H2 |
| InChIKey | BNVANNDIVCOALG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|