C11H16ClN3O4S2 — CID 80734863
1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpiperidin-4-amine (PubChem CID 80734863) has the molecular formula C11H16ClN3O4S2 and a molecular weight of 353.85 g/mol. Its IUPAC name is 1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 80734863 |
| Molecular Formula | C11H16ClN3O4S2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpiperidin-4-amine |
| SMILES | CN(C)C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)CC1 |
| InChI | InChI=1S/C11H16ClN3O4S2/c1-13(2)8-3-5-14(6-4-8)21(18,19)10-7-9(15(16)17)11(12)20-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | GRDGWPYJMLJACI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|