About 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol
1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol (PubChem CID 106668722) has the molecular formula C8H9ClN2O6S2
and a molecular weight of 328.76 g/mol. Its IUPAC name is 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol |
| PubChem CID | 106668722 |
| Molecular Formula | C8H9ClN2O6S2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CC(O)C(O)C2)sc1Cl |
| InChI | InChI=1S/C8H9ClN2O6S2/c9-8-4(11(14)15)1-7(18-8)19(16,17)10-2-5(12)6(13)3-10/h1,5-6,12-13H,2-3H2 |
| InChIKey | HIUQXLRHZQLPBP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol?
The IUPAC name of 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol (CID 106668722) is 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol.
What is the SMILES notation for 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol?
The canonical SMILES for 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol is O=[N+]([O-])c1cc(S(=O)(=O)N2CC(O)C(O)C2)sc1Cl.
What is the InChIKey of 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol?
The InChIKey is HIUQXLRHZQLPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O6S2/c9-8-4(11(14)15)1-7(18-8)19(16,17)10-2-5(12)6(13)3-10/h1,5-6,12-13H,2-3H2.
What are the key properties of 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol?
1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol has a molecular weight of 328.76 g/mol, XLogP of 0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpyrrolidine-3,4-diol is sourced from PubChem (CID 106668722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).