C11H14ClN3O4S2 — CID 102681204
(4aS,7aS)-6-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102681204) has the molecular formula C11H14ClN3O4S2 and a molecular weight of 351.84 g/mol. Its IUPAC name is (4aS,7aS)-6-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102681204 |
| Molecular Formula | C11H14ClN3O4S2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | (4aS,7aS)-6-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2C[C@@H]3CCCN[C@@H]3C2)sc1Cl |
| InChI | InChI=1S/C11H14ClN3O4S2/c12-11-9(15(16)17)4-10(20-11)21(18,19)14-5-7-2-1-3-13-8(7)6-14/h4,7-8,13H,1-3,5-6H2/t7-,8+/m0/s1 |
| InChIKey | FDJITUIZCGTLSU-JGVFFNPUSA-N |
| XLogP | 1.68 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|