C13H16Cl2N2O2S — CID 102681185
(4aS,7aS)-6-(3,4-dichlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102681185) has the molecular formula C13H16Cl2N2O2S and a molecular weight of 335.26 g/mol. Its IUPAC name is (4aS,7aS)-6-(3,4-dichlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-(3,4-dichlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102681185 |
| Molecular Formula | C13H16Cl2N2O2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | (4aS,7aS)-6-(3,4-dichlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1C[C@@H]2CCCN[C@@H]2C1 |
| InChI | InChI=1S/C13H16Cl2N2O2S/c14-11-4-3-10(6-12(11)15)20(18,19)17-7-9-2-1-5-16-13(9)8-17/h3-4,6,9,13,16H,1-2,5,7-8H2/t9-,13+/m0/s1 |
| InChIKey | UAYZTLAGCRGYKF-TVQRCGJNSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |