C13H17ClN2O2S — CID 102681021
6-(2-chlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102681021) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-(2-chlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102681021 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 6-(2-chlorophenyl)sulfonyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CC2CCCNC2C1 |
| InChI | InChI=1S/C13H17ClN2O2S/c14-11-5-1-2-6-13(11)19(17,18)16-8-10-4-3-7-15-12(10)9-16/h1-2,5-6,10,12,15H,3-4,7-9H2 |
| InChIKey | OLHSLNCGVFRCGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |