C9H11ClN2O4S3 — CID 80742515
4-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,4-thiazepane (PubChem CID 80742515) has the molecular formula C9H11ClN2O4S3 and a molecular weight of 342.85 g/mol. Its IUPAC name is 4-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,4-thiazepane.
| Compound Name | 4-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 80742515 |
| Molecular Formula | C9H11ClN2O4S3 |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 4-(5-chloro-4-nitrothiophen-2-yl)sulfonyl-1,4-thiazepane |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCSCC2)sc1Cl |
| InChI | InChI=1S/C9H11ClN2O4S3/c10-9-7(12(13)14)6-8(18-9)19(15,16)11-2-1-4-17-5-3-11/h6H,1-5H2 |
| InChIKey | NLMHPPITIOHQJO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|