C10H14ClN3O4S2 — CID 80742538
[1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperidin-3-yl]methanamine (PubChem CID 80742538) has the molecular formula C10H14ClN3O4S2 and a molecular weight of 339.83 g/mol. Its IUPAC name is [1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperidin-3-yl]methanamine.
| Compound Name | [1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperidin-3-yl]methanamine |
|---|---|
| PubChem CID | 80742538 |
| Molecular Formula | C10H14ClN3O4S2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | [1-(5-chloro-4-nitrothiophen-2-yl)sulfonylpiperidin-3-yl]methanamine |
| SMILES | NCC1CCCN(S(=O)(=O)c2cc([N+](=O)[O-])c(Cl)s2)C1 |
| InChI | InChI=1S/C10H14ClN3O4S2/c11-10-8(14(15)16)4-9(19-10)20(17,18)13-3-1-2-7(5-12)6-13/h4,7H,1-3,5-6,12H2 |
| InChIKey | YEMUFEZKEUPHOR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|