C10H16N4O4S2 — CID 80747118
1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpyrrolidin-3-amine (PubChem CID 80747118) has the molecular formula C10H16N4O4S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 80747118 |
| Molecular Formula | C10H16N4O4S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-(5-amino-4-nitrothiophen-2-yl)sulfonyl-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)C1 |
| InChI | InChI=1S/C10H16N4O4S2/c1-12(2)7-3-4-13(6-7)20(17,18)9-5-8(14(15)16)10(11)19-9/h5,7H,3-4,6,11H2,1-2H3 |
| InChIKey | QEVPJZGFMYVVHP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|