C11H18N4O4S2 — CID 80731160
3-nitro-5-(3,3,4-trimethylpiperazin-1-yl)sulfonylthiophen-2-amine (PubChem CID 80731160) has the molecular formula C11H18N4O4S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-nitro-5-(3,3,4-trimethylpiperazin-1-yl)sulfonylthiophen-2-amine.
| Compound Name | 3-nitro-5-(3,3,4-trimethylpiperazin-1-yl)sulfonylthiophen-2-amine |
|---|---|
| PubChem CID | 80731160 |
| Molecular Formula | C11H18N4O4S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-nitro-5-(3,3,4-trimethylpiperazin-1-yl)sulfonylthiophen-2-amine |
| SMILES | CN1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)CC1(C)C |
| InChI | InChI=1S/C11H18N4O4S2/c1-11(2)7-14(5-4-13(11)3)21(18,19)9-6-8(15(16)17)10(12)20-9/h6H,4-5,7,12H2,1-3H3 |
| InChIKey | JZWWYOCOXLMUBM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|