C8H11N3O6S3 — CID 80747585
5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-3-nitrothiophen-2-amine (PubChem CID 80747585) has the molecular formula C8H11N3O6S3 and a molecular weight of 341.39 g/mol. Its IUPAC name is 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-3-nitrothiophen-2-amine.
| Compound Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 80747585 |
| Molecular Formula | C8H11N3O6S3 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 5-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-3-nitrothiophen-2-amine |
| SMILES | Nc1sc(S(=O)(=O)N2CCS(=O)(=O)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O6S3/c9-8-6(11(12)13)5-7(18-8)20(16,17)10-1-3-19(14,15)4-2-10/h5H,1-4,9H2 |
| InChIKey | AYOUDZWFUHEKSF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|