C10H11BrN2O6S2 — CID 61015611
4-(5-bromo-2-nitrophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 61015611) has the molecular formula C10H11BrN2O6S2 and a molecular weight of 399.24 g/mol. Its IUPAC name is 4-(5-bromo-2-nitrophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(5-bromo-2-nitrophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 61015611 |
| Molecular Formula | C10H11BrN2O6S2 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | 4-(5-bromo-2-nitrophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1S(=O)(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H11BrN2O6S2/c11-8-1-2-9(13(14)15)10(7-8)21(18,19)12-3-5-20(16,17)6-4-12/h1-2,7H,3-6H2 |
| InChIKey | DCKQVAUPWOBAJA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|