C10H11BrFNO4S2 — CID 116528119
4-(4-bromo-2-fluorophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide (PubChem CID 116528119) has the molecular formula C10H11BrFNO4S2 and a molecular weight of 372.24 g/mol. Its IUPAC name is 4-(4-bromo-2-fluorophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(4-bromo-2-fluorophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 116528119 |
| Molecular Formula | C10H11BrFNO4S2 |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 4-(4-bromo-2-fluorophenyl)sulfonyl-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)c2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C10H11BrFNO4S2/c11-8-1-2-10(9(12)7-8)19(16,17)13-3-5-18(14,15)6-4-13/h1-2,7H,3-6H2 |
| InChIKey | YTLBDGVIJRJNOV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |