C11H14BrFN2O4S2 — CID 116528265
1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylsulfonylpiperazine (PubChem CID 116528265) has the molecular formula C11H14BrFN2O4S2 and a molecular weight of 401.28 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylsulfonylpiperazine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 116528265 |
| Molecular Formula | C11H14BrFN2O4S2 |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)sulfonyl-4-methylsulfonylpiperazine |
| SMILES | CS(=O)(=O)N1CCN(S(=O)(=O)c2ccc(Br)cc2F)CC1 |
| InChI | InChI=1S/C11H14BrFN2O4S2/c1-20(16,17)14-4-6-15(7-5-14)21(18,19)11-3-2-9(12)8-10(11)13/h2-3,8H,4-7H2,1H3 |
| InChIKey | AHNHWWKGBKUXCW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |