C10H13BrN2O4S2 — CID 65206857
4-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline (PubChem CID 65206857) has the molecular formula C10H13BrN2O4S2 and a molecular weight of 369.26 g/mol. Its IUPAC name is 4-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline.
| Compound Name | 4-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 65206857 |
| Molecular Formula | C10H13BrN2O4S2 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 4-bromo-3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]aniline |
| SMILES | Nc1ccc(Br)c(S(=O)(=O)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C10H13BrN2O4S2/c11-9-2-1-8(12)7-10(9)19(16,17)13-3-5-18(14,15)6-4-13/h1-2,7H,3-6,12H2 |
| InChIKey | AZIBXWXFJUEEQH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|