C12H15BrClN3O4S — CID 120665530
(3aS,6aR)-5-(4-bromo-2-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120665530) has the molecular formula C12H15BrClN3O4S and a molecular weight of 412.69 g/mol. Its IUPAC name is (3aS,6aR)-5-(4-bromo-2-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5-(4-bromo-2-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120665530 |
| Molecular Formula | C12H15BrClN3O4S |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | (3aS,6aR)-5-(4-bromo-2-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(Br)ccc1S(=O)(=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C12H14BrN3O4S.ClH/c13-10-1-2-12(11(3-10)16(17)18)21(19,20)15-6-8-4-14-5-9(8)7-15;/h1-3,8-9,14H,4-7H2;1H/t8-,9+; |
| InChIKey | PKPMYWSJLOBWGO-UFIFRZAQSA-N |
| XLogP | 1.62 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|