C13H17N3O5S — CID 120665463
(3aR,6aS)-5-(3-methoxy-4-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 120665463) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is (3aR,6aS)-5-(3-methoxy-4-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(3-methoxy-4-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 120665463 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (3aR,6aS)-5-(3-methoxy-4-nitrophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | COc1cc(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O5S/c1-21-13-4-11(2-3-12(13)16(17)18)22(19,20)15-7-9-5-14-6-10(9)8-15/h2-4,9-10,14H,5-8H2,1H3/t9-,10+ |
| InChIKey | MLLYGSGSWYWBJS-AOOOYVTPSA-N |
| XLogP | 0.44 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|