C14H21ClN2O4S — CID 120665492
(3aS,6aR)-5-(3,4-dimethoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120665492) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is (3aS,6aR)-5-(3,4-dimethoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5-(3,4-dimethoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120665492 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (3aS,6aR)-5-(3,4-dimethoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)cc1OC.Cl |
| InChI | InChI=1S/C14H20N2O4S.ClH/c1-19-13-4-3-12(5-14(13)20-2)21(17,18)16-8-10-6-15-7-11(10)9-16;/h3-5,10-11,15H,6-9H2,1-2H3;1H/t10-,11+; |
| InChIKey | WBBJVJQGAPEZOP-NJJJQDLFSA-N |
| XLogP | 0.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |