C17H21ClN2O3S — CID 120665313
(3aR,6aS)-5-(4-methoxynaphthalen-1-yl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120665313) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-methoxynaphthalen-1-yl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-(4-methoxynaphthalen-1-yl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120665313 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (3aR,6aS)-5-(4-methoxynaphthalen-1-yl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)c2ccccc12.Cl |
| InChI | InChI=1S/C17H20N2O3S.ClH/c1-22-16-6-7-17(15-5-3-2-4-14(15)16)23(20,21)19-10-12-8-18-9-13(12)11-19;/h2-7,12-13,18H,8-11H2,1H3;1H/t12-,13+; |
| InChIKey | FVSDAJUZDAFTNN-OEEJBDNKSA-N |
| XLogP | 2.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |