C13H16BrFN2O3S — CID 120714103
(3aR,6aS)-5-(4-bromo-5-fluoro-2-methoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 120714103) has the molecular formula C13H16BrFN2O3S and a molecular weight of 379.25 g/mol. Its IUPAC name is (3aR,6aS)-5-(4-bromo-5-fluoro-2-methoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(4-bromo-5-fluoro-2-methoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 120714103 |
| Molecular Formula | C13H16BrFN2O3S |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (3aR,6aS)-5-(4-bromo-5-fluoro-2-methoxyphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | COc1cc(Br)c(F)cc1S(=O)(=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C13H16BrFN2O3S/c1-20-12-2-10(14)11(15)3-13(12)21(18,19)17-6-8-4-16-5-9(8)7-17/h2-3,8-9,16H,4-7H2,1H3/t8-,9+ |
| InChIKey | QOYAXNOLDRTJSL-DTORHVGOSA-N |
| XLogP | 1.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |