C13H18BrFN2O3S — CID 120707436
4-bromo-5-fluoro-2-methoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 120707436) has the molecular formula C13H18BrFN2O3S and a molecular weight of 381.27 g/mol. Its IUPAC name is 4-bromo-5-fluoro-2-methoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 4-bromo-5-fluoro-2-methoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 120707436 |
| Molecular Formula | C13H18BrFN2O3S |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 4-bromo-5-fluoro-2-methoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | COc1cc(Br)c(F)cc1S(=O)(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C13H18BrFN2O3S/c1-17(9-3-5-16-6-4-9)21(18,19)13-8-11(15)10(14)7-12(13)20-2/h7-9,16H,3-6H2,1-2H3 |
| InChIKey | BSLFJHRTLKEQGD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |