C14H21BrN2O3S — CID 43606983
5-bromo-2-ethoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 43606983) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 5-bromo-2-ethoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 43606983 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-bromo-2-ethoxy-N-methyl-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | CCOc1ccc(Br)cc1S(=O)(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C14H21BrN2O3S/c1-3-20-13-5-4-11(15)10-14(13)21(18,19)17(2)12-6-8-16-9-7-12/h4-5,10,12,16H,3,6-9H2,1-2H3 |
| InChIKey | IKTOWLHSNKDTFW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |