C12H13BrF2N2O2S — CID 120665338
(3aR,6aS)-5-(5-bromo-2,4-difluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 120665338) has the molecular formula C12H13BrF2N2O2S and a molecular weight of 367.22 g/mol. Its IUPAC name is (3aR,6aS)-5-(5-bromo-2,4-difluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-(5-bromo-2,4-difluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 120665338 |
| Molecular Formula | C12H13BrF2N2O2S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | (3aR,6aS)-5-(5-bromo-2,4-difluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1cc(Br)c(F)cc1F)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C12H13BrF2N2O2S/c13-9-1-12(11(15)2-10(9)14)20(18,19)17-5-7-3-16-4-8(7)6-17/h1-2,7-8,16H,3-6H2/t7-,8+ |
| InChIKey | IBNMXWJVKZZNPU-OCAPTIKFSA-N |
| XLogP | 1.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|