C13H18ClFN2O2S — CID 120665542
(3aS,6aR)-5-(3-fluoro-2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120665542) has the molecular formula C13H18ClFN2O2S and a molecular weight of 320.82 g/mol. Its IUPAC name is (3aS,6aR)-5-(3-fluoro-2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5-(3-fluoro-2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120665542 |
| Molecular Formula | C13H18ClFN2O2S |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (3aS,6aR)-5-(3-fluoro-2-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cc1c(F)cccc1S(=O)(=O)N1C[C@H]2CNC[C@H]2C1.Cl |
| InChI | InChI=1S/C13H17FN2O2S.ClH/c1-9-12(14)3-2-4-13(9)19(17,18)16-7-10-5-15-6-11(10)8-16;/h2-4,10-11,15H,5-8H2,1H3;1H/t10-,11+; |
| InChIKey | JSIVIPCUUMCHQA-NJJJQDLFSA-N |
| XLogP | 1.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |