C13H17BrF2N2O2S — CID 119984491
1-[1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-yl]ethanamine (PubChem CID 119984491) has the molecular formula C13H17BrF2N2O2S and a molecular weight of 383.26 g/mol. Its IUPAC name is 1-[1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-yl]ethanamine.
| Compound Name | 1-[1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 119984491 |
| Molecular Formula | C13H17BrF2N2O2S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 1-[1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCCN(S(=O)(=O)c2cc(Br)c(F)cc2F)C1 |
| InChI | InChI=1S/C13H17BrF2N2O2S/c1-8(17)9-3-2-4-18(7-9)21(19,20)13-5-10(14)11(15)6-12(13)16/h5-6,8-9H,2-4,7,17H2,1H3 |
| InChIKey | UYQNBUBORZWMEQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|