C11H13BrF2N2O2S — CID 166174792
(3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-amine (PubChem CID 166174792) has the molecular formula C11H13BrF2N2O2S and a molecular weight of 355.20 g/mol. Its IUPAC name is (3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-amine.
| Compound Name | (3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 166174792 |
| Molecular Formula | C11H13BrF2N2O2S |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | (3S)-1-(5-bromo-2,4-difluorophenyl)sulfonylpiperidin-3-amine |
| SMILES | N[C@H]1CCCN(S(=O)(=O)c2cc(Br)c(F)cc2F)C1 |
| InChI | InChI=1S/C11H13BrF2N2O2S/c12-8-4-11(10(14)5-9(8)13)19(17,18)16-3-1-2-7(15)6-16/h4-5,7H,1-3,6,15H2/t7-/m0/s1 |
| InChIKey | GMXNTFOGIIGSPQ-ZETCQYMHSA-N |
| XLogP | 1.84 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|