About (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine
(3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine (PubChem CID 115301816) has the molecular formula C10H11F2N3O4S
and a molecular weight of 307.28 g/mol. Its IUPAC name is (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine |
| PubChem CID | 115301816 |
| Molecular Formula | C10H11F2N3O4S |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(F)cc2F)C1 |
| InChI | InChI=1S/C10H11F2N3O4S/c11-7-3-8(12)10(4-9(7)15(16)17)20(18,19)14-2-1-6(13)5-14/h3-4,6H,1-2,5,13H2/t6-/m1/s1 |
| InChIKey | GDVKSDAXLFFTEU-ZCFIWIBFSA-N |
| XLogP | 0.59 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine?
The IUPAC name of (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine (CID 115301816) is (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine.
What is the SMILES notation for (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine?
The canonical SMILES for (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine is N[C@@H]1CCN(S(=O)(=O)c2cc([N+](=O)[O-])c(F)cc2F)C1.
What is the InChIKey of (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine?
The InChIKey is GDVKSDAXLFFTEU-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H11F2N3O4S/c11-7-3-8(12)10(4-9(7)15(16)17)20(18,19)14-2-1-6(13)5-14/h3-4,6H,1-2,5,13H2/t6-/m1/s1.
What are the key properties of (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine?
(3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine has a molecular weight of 307.28 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-amine is sourced from PubChem (CID 115301816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).