C10H10F2N2O5S — CID 79031547
(3S)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 79031547) has the molecular formula C10H10F2N2O5S and a molecular weight of 308.26 g/mol. Its IUPAC name is (3S)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3S)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 79031547 |
| Molecular Formula | C10H10F2N2O5S |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (3S)-1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CC[C@H](O)C2)c(F)cc1F |
| InChI | InChI=1S/C10H10F2N2O5S/c11-7-3-8(12)10(4-9(7)14(16)17)20(18,19)13-2-1-6(15)5-13/h3-4,6,15H,1-2,5H2/t6-/m0/s1 |
| InChIKey | SJPKOYGOJPATGC-LURJTMIESA-N |
| XLogP | 0.63 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|