C9H8F2N2O5S — CID 63104765
1-(2,4-difluoro-5-nitrophenyl)sulfonylazetidin-3-ol (PubChem CID 63104765) has the molecular formula C9H8F2N2O5S and a molecular weight of 294.24 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-nitrophenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(2,4-difluoro-5-nitrophenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 63104765 |
| Molecular Formula | C9H8F2N2O5S |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 1-(2,4-difluoro-5-nitrophenyl)sulfonylazetidin-3-ol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CC(O)C2)c(F)cc1F |
| InChI | InChI=1S/C9H8F2N2O5S/c10-6-1-7(11)9(2-8(6)13(15)16)19(17,18)12-3-5(14)4-12/h1-2,5,14H,3-4H2 |
| InChIKey | IFWFWDHBWJMYBH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|