C10H10F2N2O6S — CID 106672318
1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 106672318) has the molecular formula C10H10F2N2O6S and a molecular weight of 324.26 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | 1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672318 |
| Molecular Formula | C10H10F2N2O6S |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 1-(2,4-difluoro-5-nitrophenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CC(O)C(O)C2)c(F)cc1F |
| InChI | InChI=1S/C10H10F2N2O6S/c11-5-1-6(12)10(2-7(5)14(17)18)21(19,20)13-3-8(15)9(16)4-13/h1-2,8-9,15-16H,3-4H2 |
| InChIKey | OUMSGFIIBDDVSX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|