C11H14N2O5S — CID 63105522
1-(3,4-dimethyl-5-nitrophenyl)sulfonylazetidin-3-ol (PubChem CID 63105522) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-(3,4-dimethyl-5-nitrophenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(3,4-dimethyl-5-nitrophenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 63105522 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(3,4-dimethyl-5-nitrophenyl)sulfonylazetidin-3-ol |
| SMILES | Cc1cc(S(=O)(=O)N2CC(O)C2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H14N2O5S/c1-7-3-10(4-11(8(7)2)13(15)16)19(17,18)12-5-9(14)6-12/h3-4,9,14H,5-6H2,1-2H3 |
| InChIKey | AXBLNQNOTLWGRT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|