C14H20N2O5S — CID 7574320
(2S,6S)-4-(3,4-dimethyl-5-nitrophenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 7574320) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is (2S,6S)-4-(3,4-dimethyl-5-nitrophenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-(3,4-dimethyl-5-nitrophenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 7574320 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (2S,6S)-4-(3,4-dimethyl-5-nitrophenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@H](C)O[C@@H](C)C2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H20N2O5S/c1-9-5-13(6-14(12(9)4)16(17)18)22(19,20)15-7-10(2)21-11(3)8-15/h5-6,10-11H,7-8H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | VTKFAVLZSROPRV-QWRGUYRKSA-N |
| XLogP | 2.01 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|