C14H19ClN2O5S — CID 48629705
4-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,2,6-trimethylmorpholine (PubChem CID 48629705) has the molecular formula C14H19ClN2O5S and a molecular weight of 362.84 g/mol. Its IUPAC name is 4-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,2,6-trimethylmorpholine.
| Compound Name | 4-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,2,6-trimethylmorpholine |
|---|---|
| PubChem CID | 48629705 |
| Molecular Formula | C14H19ClN2O5S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,2,6-trimethylmorpholine |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2CC(C)OC(C)(C)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19ClN2O5S/c1-9-7-16(8-14(3,4)22-9)23(20,21)11-5-12(15)10(2)13(6-11)17(18)19/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | PEVXEEMZJXFQFE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|