C15H21ClN4O7S2 — CID 55572820
4-[4-(3-chloro-4-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]sulfonylmorpholine (PubChem CID 55572820) has the molecular formula C15H21ClN4O7S2 and a molecular weight of 468.94 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[4-(3-chloro-4-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 55572820 |
| Molecular Formula | C15H21ClN4O7S2 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 4-[4-(3-chloro-4-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]sulfonylmorpholine |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2CCN(S(=O)(=O)N3CCOCC3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21ClN4O7S2/c1-12-14(16)10-13(11-15(12)20(21)22)28(23,24)17-2-4-18(5-3-17)29(25,26)19-6-8-27-9-7-19/h10-11H,2-9H2,1H3 |
| InChIKey | QFGSUDNEDIUIII-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 130.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|