C16H21ClN2O4S — CID 11933547
(4aS,8aS)-2-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 11933547) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is (4aS,8aS)-2-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | (4aS,8aS)-2-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11933547 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (4aS,8aS)-2-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2CC[C@@H]3CCCC[C@@H]3C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21ClN2O4S/c1-11-15(17)8-14(9-16(11)19(20)21)24(22,23)18-7-6-12-4-2-3-5-13(12)10-18/h8-9,12-13H,2-7,10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | URCKZHCWSFNEJT-QWHCGFSZSA-N |
| XLogP | 3.76 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|