C15H23NO5S2 — CID 48629637
4-(4-ethylsulfonylphenyl)sulfonyl-2,2,6-trimethylmorpholine (PubChem CID 48629637) has the molecular formula C15H23NO5S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(4-ethylsulfonylphenyl)sulfonyl-2,2,6-trimethylmorpholine.
| Compound Name | 4-(4-ethylsulfonylphenyl)sulfonyl-2,2,6-trimethylmorpholine |
|---|---|
| PubChem CID | 48629637 |
| Molecular Formula | C15H23NO5S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 4-(4-ethylsulfonylphenyl)sulfonyl-2,2,6-trimethylmorpholine |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)N2CC(C)OC(C)(C)C2)cc1 |
| InChI | InChI=1S/C15H23NO5S2/c1-5-22(17,18)13-6-8-14(9-7-13)23(19,20)16-10-12(2)21-15(3,4)11-16/h6-9,12H,5,10-11H2,1-4H3 |
| InChIKey | XANHBJDOCLBMNI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |