C10H17N3O3S — CID 47429921
2,2,6-trimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine (PubChem CID 47429921) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 2,2,6-trimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine.
| Compound Name | 2,2,6-trimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 47429921 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2,2,6-trimethyl-4-(1H-pyrazol-4-ylsulfonyl)morpholine |
| SMILES | CC1CN(S(=O)(=O)c2cn[nH]c2)CC(C)(C)O1 |
| InChI | InChI=1S/C10H17N3O3S/c1-8-6-13(7-10(2,3)16-8)17(14,15)9-4-11-12-5-9/h4-5,8H,6-7H2,1-3H3,(H,11,12) |
| InChIKey | UHMZFZAKYXPBRD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |