C13H17N3O3S — CID 115602772
5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile (PubChem CID 115602772) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile.
| Compound Name | 5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115602772 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-(2,2,6-trimethylmorpholin-4-yl)sulfonylpyridine-2-carbonitrile |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C#N)nc2)CC(C)(C)O1 |
| InChI | InChI=1S/C13H17N3O3S/c1-10-8-16(9-13(2,3)19-10)20(17,18)12-5-4-11(6-14)15-7-12/h4-5,7,10H,8-9H2,1-3H3 |
| InChIKey | JDCNMNXTNGKCIT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |