C12H16Cl2N2O3S — CID 64608987
4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2,6-trimethylmorpholine (PubChem CID 64608987) has the molecular formula C12H16Cl2N2O3S and a molecular weight of 339.24 g/mol. Its IUPAC name is 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2,6-trimethylmorpholine.
| Compound Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2,6-trimethylmorpholine |
|---|---|
| PubChem CID | 64608987 |
| Molecular Formula | C12H16Cl2N2O3S |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-2,2,6-trimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cnc(Cl)c(Cl)c2)CC(C)(C)O1 |
| InChI | InChI=1S/C12H16Cl2N2O3S/c1-8-6-16(7-12(2,3)19-8)20(17,18)9-4-10(13)11(14)15-5-9/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | LCDPPTLHYRETET-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|