C10H12Cl2N2O2S — CID 64608977
2,3-dichloro-5-(3-methylpyrrolidin-1-yl)sulfonylpyridine (PubChem CID 64608977) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is 2,3-dichloro-5-(3-methylpyrrolidin-1-yl)sulfonylpyridine.
| Compound Name | 2,3-dichloro-5-(3-methylpyrrolidin-1-yl)sulfonylpyridine |
|---|---|
| PubChem CID | 64608977 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2,3-dichloro-5-(3-methylpyrrolidin-1-yl)sulfonylpyridine |
| SMILES | CC1CCN(S(=O)(=O)c2cnc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c1-7-2-3-14(6-7)17(15,16)8-4-9(11)10(12)13-5-8/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | ONMMXJXOXVDSDM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|