C9H10Cl2N2O3S — CID 103834699
(3R)-1-[(5,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-ol (PubChem CID 103834699) has the molecular formula C9H10Cl2N2O3S and a molecular weight of 297.16 g/mol. Its IUPAC name is (3R)-1-[(5,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(5,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103834699 |
| Molecular Formula | C9H10Cl2N2O3S |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | (3R)-1-[(5,6-dichloro-3-pyridinyl)sulfonyl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C9H10Cl2N2O3S/c10-8-3-7(4-12-9(8)11)17(15,16)13-2-1-6(14)5-13/h3-4,6,14H,1-2,5H2/t6-/m1/s1 |
| InChIKey | AIPRWVKPMGHJJP-ZCFIWIBFSA-N |
| XLogP | 1.14 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|